C10H19NO2S2 — CID 10933910
3-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]-1-methylpiperidin-2-one (PubChem CID 10933910) has the molecular formula C10H19NO2S2 and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]-1-methylpiperidin-2-one.
| Compound Name | 3-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 10933910 |
| Molecular Formula | C10H19NO2S2 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]-1-methylpiperidin-2-one |
| SMILES | CSC(SC)C(O)C1CCCN(C)C1=O |
| InChI | InChI=1S/C10H19NO2S2/c1-11-6-4-5-7(9(11)13)8(12)10(14-2)15-3/h7-8,10,12H,4-6H2,1-3H3 |
| InChIKey | QHGUDEZGDACOAQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|