C18H22N4O3 — CID 109339467
N-[2-(3,4-dimethoxyphenyl)ethyl]-6-(prop-2-enylamino)pyrimidine-4-carboxamide (PubChem CID 109339467) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-6-(prop-2-enylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-6-(prop-2-enylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109339467 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-6-(prop-2-enylamino)pyrimidine-4-carboxamide |
| SMILES | C=CCNc1cc(C(=O)NCCc2ccc(OC)c(OC)c2)ncn1 |
| InChI | InChI=1S/C18H22N4O3/c1-4-8-19-17-11-14(21-12-22-17)18(23)20-9-7-13-5-6-15(24-2)16(10-13)25-3/h4-6,10-12H,1,7-9H2,2-3H3,(H,20,23)(H,19,21,22) |
| InChIKey | KJQGAEPPPQRSER-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|