C13H16O5 — CID 10933980
[(1S,3R,6R,7R,10R)-3-methoxy-10-methyl-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl] acetate (PubChem CID 10933980) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is [(1S,3R,6R,7R,10R)-3-methoxy-10-methyl-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl] acetate.
| Compound Name | [(1S,3R,6R,7R,10R)-3-methoxy-10-methyl-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl] acetate |
|---|---|
| PubChem CID | 10933980 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [(1S,3R,6R,7R,10R)-3-methoxy-10-methyl-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl] acetate |
| SMILES | CO[C@@]12OC[C@@H]3[C@@H](C)[C@@H](C=C(OC(C)=O)[C@@H]31)C2=O |
| InChI | InChI=1S/C13H16O5/c1-6-8-4-10(18-7(2)14)11-9(6)5-17-13(11,16-3)12(8)15/h4,6,8-9,11H,5H2,1-3H3/t6-,8+,9+,11+,13+/m0/s1 |
| InChIKey | SPXNLUMAURKTDO-ZJEHMPDVSA-N |
| XLogP | 0.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |