C5H7NS — CID 10934
2,4-dimethyl-1,3-thiazole (PubChem CID 10934) has the molecular formula C5H7NS and a molecular weight of 113.18 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-thiazole.
| Compound Name | 2,4-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 10934 |
| Molecular Formula | C5H7NS |
| Molecular Weight | 113.18 g/mol |
| Exact Mass | 113.03 |
| IUPAC Name | 2,4-dimethyl-1,3-thiazole |
| SMILES | Cc1csc(C)n1 |
| InChI | InChI=1S/C5H7NS/c1-4-3-7-5(2)6-4/h3H,1-2H3 |
| InChIKey | OBSLLHNATPQFMJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |