C15H17BrN4O — CID 109340731
N-(3-bromophenyl)-6-(butan-2-ylamino)pyrimidine-4-carboxamide (PubChem CID 109340731) has the molecular formula C15H17BrN4O and a molecular weight of 349.23 g/mol. Its IUPAC name is N-(3-bromophenyl)-6-(butan-2-ylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-bromophenyl)-6-(butan-2-ylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109340731 |
| Molecular Formula | C15H17BrN4O |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-(3-bromophenyl)-6-(butan-2-ylamino)pyrimidine-4-carboxamide |
| SMILES | CCC(C)Nc1cc(C(=O)Nc2cccc(Br)c2)ncn1 |
| InChI | InChI=1S/C15H17BrN4O/c1-3-10(2)19-14-8-13(17-9-18-14)15(21)20-12-6-4-5-11(16)7-12/h4-10H,3H2,1-2H3,(H,20,21)(H,17,18,19) |
| InChIKey | JVVJIZNTXBCKAE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |