C16H17BrN4O — CID 109341775
[6-(3-bromoanilino)pyrimidin-4-yl]-piperidin-1-ylmethanone (PubChem CID 109341775) has the molecular formula C16H17BrN4O and a molecular weight of 361.24 g/mol. Its IUPAC name is [6-(3-bromoanilino)pyrimidin-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [6-(3-bromoanilino)pyrimidin-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 109341775 |
| Molecular Formula | C16H17BrN4O |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [6-(3-bromoanilino)pyrimidin-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc(Nc2cccc(Br)c2)ncn1)N1CCCCC1 |
| InChI | InChI=1S/C16H17BrN4O/c17-12-5-4-6-13(9-12)20-15-10-14(18-11-19-15)16(22)21-7-2-1-3-8-21/h4-6,9-11H,1-3,7-8H2,(H,18,19,20) |
| InChIKey | DPZGXQWOUFSQPA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |