C13H12N2O2S — CID 10934215
5-hydroxy-7,9-dimethyl-1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione (PubChem CID 10934215) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 5-hydroxy-7,9-dimethyl-1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione.
| Compound Name | 5-hydroxy-7,9-dimethyl-1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 10934215 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5-hydroxy-7,9-dimethyl-1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione |
| SMILES | Cc1cc(C)c2c(c1)-c1[nH]c(=S)ncc1C(O)O2 |
| InChI | InChI=1S/C13H12N2O2S/c1-6-3-7(2)11-8(4-6)10-9(12(16)17-11)5-14-13(18)15-10/h3-5,12,16H,1-2H3,(H,14,15,18) |
| InChIKey | KYIYYGMYUYEQSY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|