C17H24O2 — CID 10934230
ethyl (6S,8R,10S)-2,6,10-trimethyltricyclo[6.3.0.03,6]undeca-1(11),2-diene-10-carboxylate (PubChem CID 10934230) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is ethyl (6S,8R,10S)-2,6,10-trimethyltricyclo[6.3.0.03,6]undeca-1(11),2-diene-10-carboxylate.
| Compound Name | ethyl (6S,8R,10S)-2,6,10-trimethyltricyclo[6.3.0.03,6]undeca-1(11),2-diene-10-carboxylate |
|---|---|
| PubChem CID | 10934230 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | ethyl (6S,8R,10S)-2,6,10-trimethyltricyclo[6.3.0.03,6]undeca-1(11),2-diene-10-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)C=C2C(C)=C3CC[C@@]3(C)C[C@@H]2C1 |
| InChI | InChI=1S/C17H24O2/c1-5-19-15(18)17(4)9-12-8-16(3)7-6-14(16)11(2)13(12)10-17/h10,12H,5-9H2,1-4H3/t12-,16+,17+/m1/s1 |
| InChIKey | UZXDIDNZRVMXRQ-DQYPLSBCSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |