C20H22 — CID 10934287
tetracyclo[7.7.2.13,15.17,11]icosa-1(16),2,7,9,11(20),15(19)-hexaene (PubChem CID 10934287) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is tetracyclo[7.7.2.13,15.17,11]icosa-1(16),2,7,9,11(20),15(19)-hexaene.
| Compound Name | tetracyclo[7.7.2.13,15.17,11]icosa-1(16),2,7,9,11(20),15(19)-hexaene |
|---|---|
| PubChem CID | 10934287 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | tetracyclo[7.7.2.13,15.17,11]icosa-1(16),2,7,9,11(20),15(19)-hexaene |
| SMILES | c1c2cc3cc1CCCc1cc(cc(c1)CC3)CCC2 |
| InChI | InChI=1S/C20H22/c1-3-15-9-17-5-2-6-18-10-16(4-1)12-20(14-18)8-7-19(11-15)13-17/h9-14H,1-8H2 |
| InChIKey | WPBYTPJODLQDJN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |