C14H14Cl2N4O2 — CID 109342902
N-(3,4-dichlorophenyl)-6-(2-methoxyethylamino)pyrimidine-4-carboxamide (PubChem CID 109342902) has the molecular formula C14H14Cl2N4O2 and a molecular weight of 341.20 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-(2-methoxyethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-6-(2-methoxyethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109342902 |
| Molecular Formula | C14H14Cl2N4O2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-(2-methoxyethylamino)pyrimidine-4-carboxamide |
| SMILES | COCCNc1cc(C(=O)Nc2ccc(Cl)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C14H14Cl2N4O2/c1-22-5-4-17-13-7-12(18-8-19-13)14(21)20-9-2-3-10(15)11(16)6-9/h2-3,6-8H,4-5H2,1H3,(H,20,21)(H,17,18,19) |
| InChIKey | YLVSZVTZJKQZMP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|