About 1,4-dibenzylpiperidine
1,4-dibenzylpiperidine (PubChem CID 10934382) has the molecular formula C19H23N
and a molecular weight of 265.40 g/mol. Its IUPAC name is 1,4-dibenzylpiperidine.
Molecular Properties
| Compound Name | 1,4-dibenzylpiperidine |
| PubChem CID | 10934382 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1,4-dibenzylpiperidine |
| SMILES | c1ccc(CC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H23N/c1-3-7-17(8-4-1)15-18-11-13-20(14-12-18)16-19-9-5-2-6-10-19/h1-10,18H,11-16H2 |
| InChIKey | USWWVZJEOYCMQL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-dibenzylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibenzylpiperidine?
The IUPAC name of 1,4-dibenzylpiperidine (CID 10934382) is 1,4-dibenzylpiperidine.
What is the SMILES notation for 1,4-dibenzylpiperidine?
The canonical SMILES for 1,4-dibenzylpiperidine is c1ccc(CC2CCN(Cc3ccccc3)CC2)cc1.
What is the InChIKey of 1,4-dibenzylpiperidine?
The InChIKey is USWWVZJEOYCMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N/c1-3-7-17(8-4-1)15-18-11-13-20(14-12-18)16-19-9-5-2-6-10-19/h1-10,18H,11-16H2.
What are the key properties of 1,4-dibenzylpiperidine?
1,4-dibenzylpiperidine has a molecular weight of 265.40 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibenzylpiperidine is sourced from PubChem (CID 10934382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).