C18H22FN5O — CID 109345258
6-(4-ethylpiperazin-1-yl)-N-[(4-fluorophenyl)methyl]pyrimidine-4-carboxamide (PubChem CID 109345258) has the molecular formula C18H22FN5O and a molecular weight of 343.41 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)-N-[(4-fluorophenyl)methyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(4-ethylpiperazin-1-yl)-N-[(4-fluorophenyl)methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109345258 |
| Molecular Formula | C18H22FN5O |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)-N-[(4-fluorophenyl)methyl]pyrimidine-4-carboxamide |
| SMILES | CCN1CCN(c2cc(C(=O)NCc3ccc(F)cc3)ncn2)CC1 |
| InChI | InChI=1S/C18H22FN5O/c1-2-23-7-9-24(10-8-23)17-11-16(21-13-22-17)18(25)20-12-14-3-5-15(19)6-4-14/h3-6,11,13H,2,7-10,12H2,1H3,(H,20,25) |
| InChIKey | SHQFLZNVOMVVPA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |