About [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate
[(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate (PubChem CID 10934531) has the molecular formula C13H18O4S
and a molecular weight of 270.35 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate |
| PubChem CID | 10934531 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C13H18O4S/c1-10-6-8-11(9-7-10)18(15,16)17-13-5-3-2-4-12(13)14/h6-9,12-14H,2-5H2,1H3/t12-,13-/m1/s1 |
| InChIKey | BIZMDVFWYSXYEJ-CHWSQXEVSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate?
The IUPAC name of [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate (CID 10934531) is [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate?
The canonical SMILES for [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)O[C@@H]2CCCC[C@H]2O)cc1.
What is the InChIKey of [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate?
The InChIKey is BIZMDVFWYSXYEJ-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H18O4S/c1-10-6-8-11(9-7-10)18(15,16)17-13-5-3-2-4-12(13)14/h6-9,12-14H,2-5H2,1H3/t12-,13-/m1/s1.
What are the key properties of [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate?
[(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate has a molecular weight of 270.35 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-hydroxycyclohexyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 10934531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).