C15H26S2 — CID 10934543
2-methyl-2-[2-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-1,3-dithiolane (PubChem CID 10934543) has the molecular formula C15H26S2 and a molecular weight of 270.51 g/mol. Its IUPAC name is 2-methyl-2-[2-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-1,3-dithiolane.
| Compound Name | 2-methyl-2-[2-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-1,3-dithiolane |
|---|---|
| PubChem CID | 10934543 |
| Molecular Formula | C15H26S2 |
| Molecular Weight | 270.51 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-methyl-2-[2-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-1,3-dithiolane |
| SMILES | CC1=CCC[C@@H](C)[C@]1(C)CCC1(C)SCCS1 |
| InChI | InChI=1S/C15H26S2/c1-12-6-5-7-13(2)14(12,3)8-9-15(4)16-10-11-17-15/h6,13H,5,7-11H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | FWEMWYWRQWEPRH-ZIAGYGMSSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|