About [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate
[(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate (PubChem CID 10934562) has the molecular formula C14H25NO4
and a molecular weight of 271.36 g/mol. Its IUPAC name is [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate.
Molecular Properties
| Compound Name | [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate |
| PubChem CID | 10934562 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate |
| SMILES | C=C[C@@H](OC(C)=O)[C@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C14H25NO4/c1-8-11(18-10(4)16)12(9(2)3)15-13(17)19-14(5,6)7/h8-9,11-12H,1H2,2-7H3,(H,15,17)/t11-,12-/m1/s1 |
| InChIKey | HDUAMBZIUNWLNY-VXGBXAGGSA-N |
| XLogP | 2.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate?
The IUPAC name of [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate (CID 10934562) is [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate.
What is the SMILES notation for [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate?
The canonical SMILES for [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate is C=C[C@@H](OC(C)=O)[C@H](NC(=O)OC(C)(C)C)C(C)C.
What is the InChIKey of [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate?
The InChIKey is HDUAMBZIUNWLNY-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H25NO4/c1-8-11(18-10(4)16)12(9(2)3)15-13(17)19-14(5,6)7/h8-9,11-12H,1H2,2-7H3,(H,15,17)/t11-,12-/m1/s1.
What are the key properties of [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate?
[(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate has a molecular weight of 271.36 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate is sourced from PubChem (CID 10934562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).