C18H13F3N4O — CID 109346615
6-(benzylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide (PubChem CID 109346615) has the molecular formula C18H13F3N4O and a molecular weight of 358.32 g/mol. Its IUPAC name is 6-(benzylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(benzylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109346615 |
| Molecular Formula | C18H13F3N4O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 6-(benzylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1cc(NCc2ccccc2)ncn1 |
| InChI | InChI=1S/C18H13F3N4O/c19-12-6-7-13(17(21)16(12)20)25-18(26)14-8-15(24-10-23-14)22-9-11-4-2-1-3-5-11/h1-8,10H,9H2,(H,25,26)(H,22,23,24) |
| InChIKey | LGKPHPOZHVTVSS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|