C18H14F2N4O — CID 109346751
N-benzyl-6-(2,4-difluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109346751) has the molecular formula C18H14F2N4O and a molecular weight of 340.33 g/mol. Its IUPAC name is N-benzyl-6-(2,4-difluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-benzyl-6-(2,4-difluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109346751 |
| Molecular Formula | C18H14F2N4O |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-benzyl-6-(2,4-difluoroanilino)pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cc(Nc2ccc(F)cc2F)ncn1 |
| InChI | InChI=1S/C18H14F2N4O/c19-13-6-7-15(14(20)8-13)24-17-9-16(22-11-23-17)18(25)21-10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H,21,25)(H,22,23,24) |
| InChIKey | OXUFTDUVJOSZJL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |