C18H17NO2 — CID 10934801
(6bR,9aS)-8-(2-methylprop-2-enoxymethyl)-6b,9a-dihydroacenaphthyleno[1,2-d][1,3]oxazole (PubChem CID 10934801) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is (6bR,9aS)-8-(2-methylprop-2-enoxymethyl)-6b,9a-dihydroacenaphthyleno[1,2-d][1,3]oxazole.
| Compound Name | (6bR,9aS)-8-(2-methylprop-2-enoxymethyl)-6b,9a-dihydroacenaphthyleno[1,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 10934801 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (6bR,9aS)-8-(2-methylprop-2-enoxymethyl)-6b,9a-dihydroacenaphthyleno[1,2-d][1,3]oxazole |
| SMILES | C=C(C)COCC1=N[C@H]2c3cccc4cccc(c34)[C@H]2O1 |
| InChI | InChI=1S/C18H17NO2/c1-11(2)9-20-10-15-19-17-13-7-3-5-12-6-4-8-14(16(12)13)18(17)21-15/h3-8,17-18H,1,9-10H2,2H3/t17-,18+/m0/s1 |
| InChIKey | QTMHKGVQFVLHKE-ZWKOTPCHSA-N |
| XLogP | 3.96 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|