C21H21ClN4O — CID 109348515
6-[(2-chlorophenyl)methylamino]-N-(3-phenylpropyl)pyrimidine-4-carboxamide (PubChem CID 109348515) has the molecular formula C21H21ClN4O and a molecular weight of 380.88 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methylamino]-N-(3-phenylpropyl)pyrimidine-4-carboxamide.
| Compound Name | 6-[(2-chlorophenyl)methylamino]-N-(3-phenylpropyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109348515 |
| Molecular Formula | C21H21ClN4O |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 6-[(2-chlorophenyl)methylamino]-N-(3-phenylpropyl)pyrimidine-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cc(NCc2ccccc2Cl)ncn1 |
| InChI | InChI=1S/C21H21ClN4O/c22-18-11-5-4-10-17(18)14-24-20-13-19(25-15-26-20)21(27)23-12-6-9-16-7-2-1-3-8-16/h1-5,7-8,10-11,13,15H,6,9,12,14H2,(H,23,27)(H,24,25,26) |
| InChIKey | RANQWMVLEVVIQZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|