C22H24N4O2 — CID 109349158
N-[(4-methoxyphenyl)methyl]-6-(3-phenylpropylamino)pyrimidine-4-carboxamide (PubChem CID 109349158) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-6-(3-phenylpropylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-6-(3-phenylpropylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109349158 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-6-(3-phenylpropylamino)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cc(NCCCc3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C22H24N4O2/c1-28-19-11-9-18(10-12-19)15-24-22(27)20-14-21(26-16-25-20)23-13-5-8-17-6-3-2-4-7-17/h2-4,6-7,9-12,14,16H,5,8,13,15H2,1H3,(H,24,27)(H,23,25,26) |
| InChIKey | GNAGOSBFFYDTLT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|