C16H28O4 — CID 10934978
(2R,3S,4S,6S,8R,10S)-3-methyl-2-propan-2-yl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecane-4,10-diol (PubChem CID 10934978) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R,3S,4S,6S,8R,10S)-3-methyl-2-propan-2-yl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecane-4,10-diol.
| Compound Name | (2R,3S,4S,6S,8R,10S)-3-methyl-2-propan-2-yl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecane-4,10-diol |
|---|---|
| PubChem CID | 10934978 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2R,3S,4S,6S,8R,10S)-3-methyl-2-propan-2-yl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecane-4,10-diol |
| SMILES | C=CC[C@@H]1C[C@H](O)C[C@]2(C[C@H](O)[C@H](C)[C@@H](C(C)C)O2)O1 |
| InChI | InChI=1S/C16H28O4/c1-5-6-13-7-12(17)8-16(19-13)9-14(18)11(4)15(20-16)10(2)3/h5,10-15,17-18H,1,6-9H2,2-4H3/t11-,12-,13+,14-,15+,16-/m0/s1 |
| InChIKey | FVZDFSDWBHEMKP-KLOLGFOXSA-N |
| XLogP | 2.24 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|