About N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide
N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide (PubChem CID 10935011) has the molecular formula C14H20FNO2S
and a molecular weight of 285.38 g/mol. Its IUPAC name is N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide |
| PubChem CID | 10935011 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)N[C@@H]1CCC[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C14H20FNO2S/c1-10(2)19(17,18)16-14-8-4-7-13(14)11-5-3-6-12(15)9-11/h3,5-6,9-10,13-14,16H,4,7-8H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | FICTUDUWXVYNJJ-ZIAGYGMSSA-N |
| XLogP | 2.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide?
The IUPAC name of N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide (CID 10935011) is N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide.
What is the SMILES notation for N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide?
The canonical SMILES for N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide is CC(C)S(=O)(=O)N[C@@H]1CCC[C@@H]1c1cccc(F)c1.
What is the InChIKey of N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide?
The InChIKey is FICTUDUWXVYNJJ-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H20FNO2S/c1-10(2)19(17,18)16-14-8-4-7-13(14)11-5-3-6-12(15)9-11/h3,5-6,9-10,13-14,16H,4,7-8H2,1-2H3/t13-,14-/m1/s1.
What are the key properties of N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide?
N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide has a molecular weight of 285.38 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-(3-fluorophenyl)cyclopentyl]propane-2-sulfonamide is sourced from PubChem (CID 10935011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).