C10H11Cl3O3 — CID 10935019
2,3,5-trichloro-4,4-dimethoxy-5-prop-2-enylcyclopent-2-en-1-one (PubChem CID 10935019) has the molecular formula C10H11Cl3O3 and a molecular weight of 285.55 g/mol. Its IUPAC name is 2,3,5-trichloro-4,4-dimethoxy-5-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | 2,3,5-trichloro-4,4-dimethoxy-5-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10935019 |
| Molecular Formula | C10H11Cl3O3 |
| Molecular Weight | 285.55 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 2,3,5-trichloro-4,4-dimethoxy-5-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CCC1(Cl)C(=O)C(Cl)=C(Cl)C1(OC)OC |
| InChI | InChI=1S/C10H11Cl3O3/c1-4-5-9(13)8(14)6(11)7(12)10(9,15-2)16-3/h4H,1,5H2,2-3H3 |
| InChIKey | KKSPRMWQDCCVKC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|