C20H21N5O — CID 109350192
N-(4-propan-2-ylphenyl)-6-(pyridin-4-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109350192) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is N-(4-propan-2-ylphenyl)-6-(pyridin-4-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-propan-2-ylphenyl)-6-(pyridin-4-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109350192 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-(4-propan-2-ylphenyl)-6-(pyridin-4-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)c2cc(NCc3ccncc3)ncn2)cc1 |
| InChI | InChI=1S/C20H21N5O/c1-14(2)16-3-5-17(6-4-16)25-20(26)18-11-19(24-13-23-18)22-12-15-7-9-21-10-8-15/h3-11,13-14H,12H2,1-2H3,(H,25,26)(H,22,23,24) |
| InChIKey | LXEJMVPPIKFFAG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |