C21H29N5O — CID 109352116
[6-(dipropylamino)pyrimidin-4-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 109352116) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is [6-(dipropylamino)pyrimidin-4-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [6-(dipropylamino)pyrimidin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109352116 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | [6-(dipropylamino)pyrimidin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | CCCN(CCC)c1cc(C(=O)N2CCN(c3ccccc3)CC2)ncn1 |
| InChI | InChI=1S/C21H29N5O/c1-3-10-25(11-4-2)20-16-19(22-17-23-20)21(27)26-14-12-24(13-15-26)18-8-6-5-7-9-18/h5-9,16-17H,3-4,10-15H2,1-2H3 |
| InChIKey | JVKADWRNSLMPDH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |