C16H20O5 — CID 10935216
dimethyl (1R,8S)-4,4-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),9-diene-9,10-dicarboxylate (PubChem CID 10935216) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is dimethyl (1R,8S)-4,4-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),9-diene-9,10-dicarboxylate.
| Compound Name | dimethyl (1R,8S)-4,4-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),9-diene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 10935216 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | dimethyl (1R,8S)-4,4-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),9-diene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H]2O[C@@H]1C1=C2CCC(C)(C)C1 |
| InChI | InChI=1S/C16H20O5/c1-16(2)6-5-8-9(7-16)13-11(15(18)20-4)10(12(8)21-13)14(17)19-3/h12-13H,5-7H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | CILJBMBOTABXRN-QWHCGFSZSA-N |
| XLogP | 1.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|