C9H6ClF6NO — CID 10935260
4-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-6-methyl-1H-pyridin-2-one (PubChem CID 10935260) has the molecular formula C9H6ClF6NO and a molecular weight of 293.59 g/mol. Its IUPAC name is 4-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-6-methyl-1H-pyridin-2-one.
| Compound Name | 4-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-6-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 10935260 |
| Molecular Formula | C9H6ClF6NO |
| Molecular Weight | 293.59 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 4-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-6-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C(F)(F)C(F)(F)C(F)(F)Cl)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H6ClF6NO/c1-4-2-5(3-6(18)17-4)7(11,12)8(13,14)9(10,15)16/h2-3H,1H3,(H,17,18) |
| InChIKey | ROXQYQTZICDKLR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|