C14H16O7 — CID 10935321
methyl (4'aS,5'R,8'aS)-5'-hydroxy-4',8'-dioxospiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate (PubChem CID 10935321) has the molecular formula C14H16O7 and a molecular weight of 296.27 g/mol. Its IUPAC name is methyl (4'aS,5'R,8'aS)-5'-hydroxy-4',8'-dioxospiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate.
| Compound Name | methyl (4'aS,5'R,8'aS)-5'-hydroxy-4',8'-dioxospiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate |
|---|---|
| PubChem CID | 10935321 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | methyl (4'aS,5'R,8'aS)-5'-hydroxy-4',8'-dioxospiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CCC3(OCCO3)[C@@H]1C(=O)C=C[C@H]2O |
| InChI | InChI=1S/C14H16O7/c1-19-12(18)14-9(16)3-2-8(15)11(14)13(5-4-10(14)17)20-6-7-21-13/h2-3,9,11,16H,4-7H2,1H3/t9-,11+,14+/m1/s1 |
| InChIKey | JRPLKDZNXKLGJE-PUYPPJJSSA-N |
| XLogP | -0.63 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|