About N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide
N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide (PubChem CID 10935341) has the molecular formula C16H28N2O3
and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide.
Molecular Properties
| Compound Name | N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide |
| PubChem CID | 10935341 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide |
| SMILES | CCCCCCCCCCC(=O)N[C@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H28N2O3/c1-2-3-4-5-6-7-8-9-10-14(19)17-13-11-12-15(20)18-16(13)21/h13H,2-12H2,1H3,(H,17,19)(H,18,20,21)/t13-/m0/s1 |
| InChIKey | CDGCHMSOVNBJOE-ZDUSSCGKSA-N |
| XLogP | 2.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide?
The IUPAC name of N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide (CID 10935341) is N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide.
What is the SMILES notation for N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide?
The canonical SMILES for N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide is CCCCCCCCCCC(=O)N[C@H]1CCC(=O)NC1=O.
What is the InChIKey of N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide?
The InChIKey is CDGCHMSOVNBJOE-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H28N2O3/c1-2-3-4-5-6-7-8-9-10-14(19)17-13-11-12-15(20)18-16(13)21/h13H,2-12H2,1H3,(H,17,19)(H,18,20,21)/t13-/m0/s1.
What are the key properties of N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide?
N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide has a molecular weight of 296.41 g/mol, XLogP of 2.44, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-2,6-dioxopiperidin-3-yl]undecanamide is sourced from PubChem (CID 10935341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).