C20H19FN4O — CID 109353538
N-(4-fluorophenyl)-6-(3-phenylpropylamino)pyrimidine-4-carboxamide (PubChem CID 109353538) has the molecular formula C20H19FN4O and a molecular weight of 350.40 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-(3-phenylpropylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-6-(3-phenylpropylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109353538 |
| Molecular Formula | C20H19FN4O |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-(4-fluorophenyl)-6-(3-phenylpropylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cc(NCCCc2ccccc2)ncn1 |
| InChI | InChI=1S/C20H19FN4O/c21-16-8-10-17(11-9-16)25-20(26)18-13-19(24-14-23-18)22-12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11,13-14H,4,7,12H2,(H,25,26)(H,22,23,24) |
| InChIKey | FHBDQAFZDDZYAJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|