C19H21N5O — CID 109354032
N-(3-cyanophenyl)-6-(cycloheptylamino)pyrimidine-4-carboxamide (PubChem CID 109354032) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(3-cyanophenyl)-6-(cycloheptylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-cyanophenyl)-6-(cycloheptylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109354032 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-(3-cyanophenyl)-6-(cycloheptylamino)pyrimidine-4-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2cc(NC3CCCCCC3)ncn2)c1 |
| InChI | InChI=1S/C19H21N5O/c20-12-14-6-5-9-16(10-14)24-19(25)17-11-18(22-13-21-17)23-15-7-3-1-2-4-8-15/h5-6,9-11,13,15H,1-4,7-8H2,(H,24,25)(H,21,22,23) |
| InChIKey | LLGJZQMRCBSJQO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |