C17H19N5O — CID 109354614
6-(3-cyanoanilino)-N-pentylpyrimidine-4-carboxamide (PubChem CID 109354614) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 6-(3-cyanoanilino)-N-pentylpyrimidine-4-carboxamide.
| Compound Name | 6-(3-cyanoanilino)-N-pentylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109354614 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 6-(3-cyanoanilino)-N-pentylpyrimidine-4-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(Nc2cccc(C#N)c2)ncn1 |
| InChI | InChI=1S/C17H19N5O/c1-2-3-4-8-19-17(23)15-10-16(21-12-20-15)22-14-7-5-6-13(9-14)11-18/h5-7,9-10,12H,2-4,8H2,1H3,(H,19,23)(H,20,21,22) |
| InChIKey | WJWWYDKCVXFCNE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|