C20H26N4O3 — CID 109354998
[6-(3,4-dimethoxyanilino)pyrimidin-4-yl]-(2-ethylpiperidin-1-yl)methanone (PubChem CID 109354998) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is [6-(3,4-dimethoxyanilino)pyrimidin-4-yl]-(2-ethylpiperidin-1-yl)methanone.
| Compound Name | [6-(3,4-dimethoxyanilino)pyrimidin-4-yl]-(2-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109354998 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [6-(3,4-dimethoxyanilino)pyrimidin-4-yl]-(2-ethylpiperidin-1-yl)methanone |
| SMILES | CCC1CCCCN1C(=O)c1cc(Nc2ccc(OC)c(OC)c2)ncn1 |
| InChI | InChI=1S/C20H26N4O3/c1-4-15-7-5-6-10-24(15)20(25)16-12-19(22-13-21-16)23-14-8-9-17(26-2)18(11-14)27-3/h8-9,11-13,15H,4-7,10H2,1-3H3,(H,21,22,23) |
| InChIKey | TZUCRZZESKJRST-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |