C21H31N5O — CID 109355395
6-[4-(diethylamino)anilino]-N,N-dipropylpyrimidine-4-carboxamide (PubChem CID 109355395) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 6-[4-(diethylamino)anilino]-N,N-dipropylpyrimidine-4-carboxamide.
| Compound Name | 6-[4-(diethylamino)anilino]-N,N-dipropylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109355395 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 6-[4-(diethylamino)anilino]-N,N-dipropylpyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(Nc2ccc(N(CC)CC)cc2)ncn1 |
| InChI | InChI=1S/C21H31N5O/c1-5-13-26(14-6-2)21(27)19-15-20(23-16-22-19)24-17-9-11-18(12-10-17)25(7-3)8-4/h9-12,15-16H,5-8,13-14H2,1-4H3,(H,22,23,24) |
| InChIKey | YNTZKSUVGUEYTH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|