C19H14Cl2N4O — CID 109356579
N-(2,5-dichlorophenyl)-6-(2,3-dihydroindol-1-yl)pyrimidine-4-carboxamide (PubChem CID 109356579) has the molecular formula C19H14Cl2N4O and a molecular weight of 385.25 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-6-(2,3-dihydroindol-1-yl)pyrimidine-4-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-6-(2,3-dihydroindol-1-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109356579 |
| Molecular Formula | C19H14Cl2N4O |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-(2,5-dichlorophenyl)-6-(2,3-dihydroindol-1-yl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)c1cc(N2CCc3ccccc32)ncn1 |
| InChI | InChI=1S/C19H14Cl2N4O/c20-13-5-6-14(21)15(9-13)24-19(26)16-10-18(23-11-22-16)25-8-7-12-3-1-2-4-17(12)25/h1-6,9-11H,7-8H2,(H,24,26) |
| InChIKey | GFJJPIVKNUZJST-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |