C22H22N4O — CID 109356603
2,3-dihydroindol-1-yl-[6-(2-propan-2-ylanilino)pyrimidin-4-yl]methanone (PubChem CID 109356603) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[6-(2-propan-2-ylanilino)pyrimidin-4-yl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[6-(2-propan-2-ylanilino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109356603 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[6-(2-propan-2-ylanilino)pyrimidin-4-yl]methanone |
| SMILES | CC(C)c1ccccc1Nc1cc(C(=O)N2CCc3ccccc32)ncn1 |
| InChI | InChI=1S/C22H22N4O/c1-15(2)17-8-4-5-9-18(17)25-21-13-19(23-14-24-21)22(27)26-12-11-16-7-3-6-10-20(16)26/h3-10,13-15H,11-12H2,1-2H3,(H,23,24,25) |
| InChIKey | UZAOMIZAMQPSLF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |