C19H17FN4O — CID 109357311
N-(2-ethylphenyl)-6-(3-fluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109357311) has the molecular formula C19H17FN4O and a molecular weight of 336.37 g/mol. Its IUPAC name is N-(2-ethylphenyl)-6-(3-fluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-ethylphenyl)-6-(3-fluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109357311 |
| Molecular Formula | C19H17FN4O |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-(2-ethylphenyl)-6-(3-fluoroanilino)pyrimidine-4-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1cc(Nc2cccc(F)c2)ncn1 |
| InChI | InChI=1S/C19H17FN4O/c1-2-13-6-3-4-9-16(13)24-19(25)17-11-18(22-12-21-17)23-15-8-5-7-14(20)10-15/h3-12H,2H2,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | UHHFXGQBKYQKPK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |