C21H22N4O3 — CID 109357426
N-(2,4-dimethoxyphenyl)-6-(N-ethylanilino)pyrimidine-4-carboxamide (PubChem CID 109357426) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-6-(N-ethylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-6-(N-ethylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109357426 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-6-(N-ethylanilino)pyrimidine-4-carboxamide |
| SMILES | CCN(c1ccccc1)c1cc(C(=O)Nc2ccc(OC)cc2OC)ncn1 |
| InChI | InChI=1S/C21H22N4O3/c1-4-25(15-8-6-5-7-9-15)20-13-18(22-14-23-20)21(26)24-17-11-10-16(27-2)12-19(17)28-3/h5-14H,4H2,1-3H3,(H,24,26) |
| InChIKey | OBMZNNNFHJPXHD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |