C8H15F3O5S2 — CID 10935868
(3R,4R,5S)-1,5-dimethylthian-1-ium-3,4-diol;trifluoromethanesulfonate (PubChem CID 10935868) has the molecular formula C8H15F3O5S2 and a molecular weight of 312.33 g/mol. Its IUPAC name is (3R,4R,5S)-1,5-dimethylthian-1-ium-3,4-diol;trifluoromethanesulfonate.
| Compound Name | (3R,4R,5S)-1,5-dimethylthian-1-ium-3,4-diol;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10935868 |
| Molecular Formula | C8H15F3O5S2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (3R,4R,5S)-1,5-dimethylthian-1-ium-3,4-diol;trifluoromethanesulfonate |
| SMILES | C[C@@H]1C[S+](C)C[C@H](O)[C@@H]1O.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C7H15O2S.CHF3O3S/c1-5-3-10(2)4-6(8)7(5)9;2-1(3,4)8(5,6)7/h5-9H,3-4H2,1-2H3;(H,5,6,7)/q+1;/p-1/t5-,6+,7-,10?;/m1./s1 |
| InChIKey | ARJBHLCUMJSBQT-JFZJCYMOSA-M |
| XLogP | -0.34 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|