C10H17BrO4S — CID 10935897
(4S,6R)-4-(bromomethyl)-6-cyclohexyl-1,3,2-dioxathiane 2,2-dioxide (PubChem CID 10935897) has the molecular formula C10H17BrO4S and a molecular weight of 313.21 g/mol. Its IUPAC name is (4S,6R)-4-(bromomethyl)-6-cyclohexyl-1,3,2-dioxathiane 2,2-dioxide.
| Compound Name | (4S,6R)-4-(bromomethyl)-6-cyclohexyl-1,3,2-dioxathiane 2,2-dioxide |
|---|---|
| PubChem CID | 10935897 |
| Molecular Formula | C10H17BrO4S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | (4S,6R)-4-(bromomethyl)-6-cyclohexyl-1,3,2-dioxathiane 2,2-dioxide |
| SMILES | O=S1(=O)O[C@H](CBr)C[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C10H17BrO4S/c11-7-9-6-10(15-16(12,13)14-9)8-4-2-1-3-5-8/h8-10H,1-7H2/t9-,10+/m0/s1 |
| InChIKey | QXKNBRHFIRKUCC-VHSXEESVSA-N |
| XLogP | 2.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|