C15H22O7 — CID 10935923
(1R,2R,4R,6R,8S)-8-hydroxy-2',2'-dimethoxyspiro[3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,1'-cyclohexane]-9-one (PubChem CID 10935923) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is (1R,2R,4R,6R,8S)-8-hydroxy-2',2'-dimethoxyspiro[3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,1'-cyclohexane]-9-one.
| Compound Name | (1R,2R,4R,6R,8S)-8-hydroxy-2',2'-dimethoxyspiro[3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,1'-cyclohexane]-9-one |
|---|---|
| PubChem CID | 10935923 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (1R,2R,4R,6R,8S)-8-hydroxy-2',2'-dimethoxyspiro[3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,1'-cyclohexane]-9-one |
| SMILES | COC1(OC)CCCC[C@@]12O[C@H]1[C@H]3C[C@@](O)(C[C@H]1O2)C(=O)O3 |
| InChI | InChI=1S/C15H22O7/c1-18-14(19-2)5-3-4-6-15(14)21-10-8-13(17)7-9(11(10)22-15)20-12(13)16/h9-11,17H,3-8H2,1-2H3/t9-,10-,11+,13-,15-/m1/s1 |
| InChIKey | QWJPPOQCPMXAJC-IMTAKKMFSA-N |
| XLogP | 0.48 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|