C14H21I — CID 10935981
2-[(1E,3E)-4-iodo-3-methylbuta-1,3-dienyl]-1,3,3-trimethylcyclohexene (PubChem CID 10935981) has the molecular formula C14H21I and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-[(1E,3E)-4-iodo-3-methylbuta-1,3-dienyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E)-4-iodo-3-methylbuta-1,3-dienyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 10935981 |
| Molecular Formula | C14H21I |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[(1E,3E)-4-iodo-3-methylbuta-1,3-dienyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/I)C(C)(C)CCC1 |
| InChI | InChI=1S/C14H21I/c1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4/h7-8,10H,5-6,9H2,1-4H3/b8-7+,11-10+ |
| InChIKey | YKROYZYTRFFKSA-ZDVGBALWSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|