C15H18N4O — CID 109360462
2-methyl-N-phenyl-6-(propan-2-ylamino)pyrimidine-4-carboxamide (PubChem CID 109360462) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-methyl-N-phenyl-6-(propan-2-ylamino)pyrimidine-4-carboxamide.
| Compound Name | 2-methyl-N-phenyl-6-(propan-2-ylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109360462 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-methyl-N-phenyl-6-(propan-2-ylamino)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(NC(C)C)cc(C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H18N4O/c1-10(2)16-14-9-13(17-11(3)18-14)15(20)19-12-7-5-4-6-8-12/h4-10H,1-3H3,(H,19,20)(H,16,17,18) |
| InChIKey | OSWILBWJKOVJTP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |