C20H26N6O — CID 109360922
6-(cyclopropylamino)-2-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-4-carboxamide (PubChem CID 109360922) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is 6-(cyclopropylamino)-2-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(cyclopropylamino)-2-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109360922 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 6-(cyclopropylamino)-2-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-4-carboxamide |
| SMILES | Cc1nc(NC2CC2)cc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)n1 |
| InChI | InChI=1S/C20H26N6O/c1-14-21-18(13-19(22-14)23-15-3-4-15)20(27)24-16-5-7-17(8-6-16)26-11-9-25(2)10-12-26/h5-8,13,15H,3-4,9-12H2,1-2H3,(H,24,27)(H,21,22,23) |
| InChIKey | KXPFVQJKEQNODT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|