C17H21BrN4O — CID 109362090
N-(4-bromo-2-methylphenyl)-2-methyl-6-(2-methylpropylamino)pyrimidine-4-carboxamide (PubChem CID 109362090) has the molecular formula C17H21BrN4O and a molecular weight of 377.29 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-methyl-6-(2-methylpropylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-methyl-6-(2-methylpropylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109362090 |
| Molecular Formula | C17H21BrN4O |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-methyl-6-(2-methylpropylamino)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(NCC(C)C)cc(C(=O)Nc2ccc(Br)cc2C)n1 |
| InChI | InChI=1S/C17H21BrN4O/c1-10(2)9-19-16-8-15(20-12(4)21-16)17(23)22-14-6-5-13(18)7-11(14)3/h5-8,10H,9H2,1-4H3,(H,22,23)(H,19,20,21) |
| InChIKey | XNCQIDSEZQDYGT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |