C20H28N4O — CID 109362604
N-butan-2-yl-6-(2,6-diethylanilino)-2-methylpyrimidine-4-carboxamide (PubChem CID 109362604) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is N-butan-2-yl-6-(2,6-diethylanilino)-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-butan-2-yl-6-(2,6-diethylanilino)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109362604 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N-butan-2-yl-6-(2,6-diethylanilino)-2-methylpyrimidine-4-carboxamide |
| SMILES | CCc1cccc(CC)c1Nc1cc(C(=O)NC(C)CC)nc(C)n1 |
| InChI | InChI=1S/C20H28N4O/c1-6-13(4)21-20(25)17-12-18(23-14(5)22-17)24-19-15(7-2)10-9-11-16(19)8-3/h9-13H,6-8H2,1-5H3,(H,21,25)(H,22,23,24) |
| InChIKey | IGIDLMCHVRFCPT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |