C15H23NO3SSi — CID 10936272
5-methyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one (PubChem CID 10936272) has the molecular formula C15H23NO3SSi and a molecular weight of 325.51 g/mol. Its IUPAC name is 5-methyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one.
| Compound Name | 5-methyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10936272 |
| Molecular Formula | C15H23NO3SSi |
| Molecular Weight | 325.51 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 5-methyl-1-(4-methylphenyl)sulfonyl-3-trimethylsilylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C([Si](C)(C)C)CC2C)cc1 |
| InChI | InChI=1S/C15H23NO3SSi/c1-11-6-8-13(9-7-11)20(18,19)16-12(2)10-14(15(16)17)21(3,4)5/h6-9,12,14H,10H2,1-5H3 |
| InChIKey | LTTXUSIRBKCETL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|