C17H19ClN4O — CID 109362803
N-(3-chloro-2-methylphenyl)-2-methyl-6-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 109362803) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-methyl-6-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-methyl-6-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109362803 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-methyl-6-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2cccc(Cl)c2C)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C17H19ClN4O/c1-11-13(18)6-5-7-14(11)21-17(23)15-10-16(20-12(2)19-15)22-8-3-4-9-22/h5-7,10H,3-4,8-9H2,1-2H3,(H,21,23) |
| InChIKey | ABIRZDJXBKKDDV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |