C22H34O2 — CID 10936441
(4aR,4bS,6aS,7S,8R,10aS,10bR)-7-methoxy-4a,6a,8-trimethyl-4,4b,5,6,7,8,9,10,10a,10b,11,12-dodecahydro-3H-chrysen-2-one (PubChem CID 10936441) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (4aR,4bS,6aS,7S,8R,10aS,10bR)-7-methoxy-4a,6a,8-trimethyl-4,4b,5,6,7,8,9,10,10a,10b,11,12-dodecahydro-3H-chrysen-2-one.
| Compound Name | (4aR,4bS,6aS,7S,8R,10aS,10bR)-7-methoxy-4a,6a,8-trimethyl-4,4b,5,6,7,8,9,10,10a,10b,11,12-dodecahydro-3H-chrysen-2-one |
|---|---|
| PubChem CID | 10936441 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (4aR,4bS,6aS,7S,8R,10aS,10bR)-7-methoxy-4a,6a,8-trimethyl-4,4b,5,6,7,8,9,10,10a,10b,11,12-dodecahydro-3H-chrysen-2-one |
| SMILES | CO[C@H]1[C@H](C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H34O2/c1-14-5-8-18-17-7-6-15-13-16(23)9-11-21(15,2)19(17)10-12-22(18,3)20(14)24-4/h13-14,17-20H,5-12H2,1-4H3/t14-,17+,18+,19+,20+,21+,22+/m1/s1 |
| InChIKey | LBQBZTLQDCEHJI-FZVWNVPGSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |