C13H22N4O2 — CID 109364679
N,N-diethyl-6-(2-methoxyethylamino)-2-methylpyrimidine-4-carboxamide (PubChem CID 109364679) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is N,N-diethyl-6-(2-methoxyethylamino)-2-methylpyrimidine-4-carboxamide.
| Compound Name | N,N-diethyl-6-(2-methoxyethylamino)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109364679 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N,N-diethyl-6-(2-methoxyethylamino)-2-methylpyrimidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NCCOC)nc(C)n1 |
| InChI | InChI=1S/C13H22N4O2/c1-5-17(6-2)13(18)11-9-12(14-7-8-19-4)16-10(3)15-11/h9H,5-8H2,1-4H3,(H,14,15,16) |
| InChIKey | DMWDCJMRKISLGV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|